About (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine
(2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine (PubChem CID 44593078) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine |
| PubChem CID | 44593078 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine |
| SMILES | Cc1cccc(C)c1SC[C@@H](C)CN |
| InChI | InChI=1S/C12H19NS/c1-9(7-13)8-14-12-10(2)5-4-6-11(12)3/h4-6,9H,7-8,13H2,1-3H3/t9-/m0/s1 |
| InChIKey | DKPRBIUBNMXBKY-VIFPVBQESA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine?
The IUPAC name of (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine (CID 44593078) is (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine.
What is the SMILES notation for (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine?
The canonical SMILES for (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine is Cc1cccc(C)c1SC[C@@H](C)CN.
What is the InChIKey of (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine?
The InChIKey is DKPRBIUBNMXBKY-VIFPVBQESA-N. The full InChI is InChI=1S/C12H19NS/c1-9(7-13)8-14-12-10(2)5-4-6-11(12)3/h4-6,9H,7-8,13H2,1-3H3/t9-/m0/s1.
What are the key properties of (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine?
(2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine has a molecular weight of 209.36 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(2,6-dimethylphenyl)sulfanyl-2-methylpropan-1-amine is sourced from PubChem (CID 44593078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).