C19H12F3NO4 — CID 44593161
8-[3-(trifluoromethyl)phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one (PubChem CID 44593161) has the molecular formula C19H12F3NO4 and a molecular weight of 375.30 g/mol. Its IUPAC name is 8-[3-(trifluoromethyl)phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one.
| Compound Name | 8-[3-(trifluoromethyl)phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
|---|---|
| PubChem CID | 44593161 |
| Molecular Formula | C19H12F3NO4 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 8-[3-(trifluoromethyl)phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
| SMILES | O=C1OCC2=C1C(c1cccc(C(F)(F)F)c1)c1cc3c(cc1N2)OCO3 |
| InChI | InChI=1S/C19H12F3NO4/c20-19(21,22)10-3-1-2-9(4-10)16-11-5-14-15(27-8-26-14)6-12(11)23-13-7-25-18(24)17(13)16/h1-6,16,23H,7-8H2 |
| InChIKey | OCVORVFKJVTXNM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |