About 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide
4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide (PubChem CID 44593178) has the molecular formula C15H12N2O4S
and a molecular weight of 316.34 g/mol. Its IUPAC name is 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide |
| PubChem CID | 44593178 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2oc(=O)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2O4S/c16-22(19,20)12-8-6-11(7-9-12)14-13(17-15(18)21-14)10-4-2-1-3-5-10/h1-9H,(H,17,18)(H2,16,19,20) |
| InChIKey | XQVSFQBKZWJYMT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide?
The IUPAC name of 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide (CID 44593178) is 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide.
What is the SMILES notation for 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide?
The canonical SMILES for 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide is NS(=O)(=O)c1ccc(-c2oc(=O)[nH]c2-c2ccccc2)cc1.
What is the InChIKey of 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide?
The InChIKey is XQVSFQBKZWJYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O4S/c16-22(19,20)12-8-6-11(7-9-12)14-13(17-15(18)21-14)10-4-2-1-3-5-10/h1-9H,(H,17,18)(H2,16,19,20).
What are the key properties of 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide?
4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide has a molecular weight of 316.34 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-4-phenyl-3H-1,3-oxazol-5-yl)benzenesulfonamide is sourced from PubChem (CID 44593178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).