C18H35BrN4S — CID 44593309
N-methyl-N-[2-[2-(4-propylpiperazin-1-yl)-1,3-thiazol-5-yl]ethyl]pentan-1-amine;hydrobromide (PubChem CID 44593309) has the molecular formula C18H35BrN4S and a molecular weight of 419.48 g/mol. Its IUPAC name is N-methyl-N-[2-[2-(4-propylpiperazin-1-yl)-1,3-thiazol-5-yl]ethyl]pentan-1-amine;hydrobromide.
| Compound Name | N-methyl-N-[2-[2-(4-propylpiperazin-1-yl)-1,3-thiazol-5-yl]ethyl]pentan-1-amine;hydrobromide |
|---|---|
| PubChem CID | 44593309 |
| Molecular Formula | C18H35BrN4S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-methyl-N-[2-[2-(4-propylpiperazin-1-yl)-1,3-thiazol-5-yl]ethyl]pentan-1-amine;hydrobromide |
| SMILES | Br.CCCCCN(C)CCc1cnc(N2CCN(CCC)CC2)s1 |
| InChI | InChI=1S/C18H34N4S.BrH/c1-4-6-7-10-20(3)11-8-17-16-19-18(23-17)22-14-12-21(9-5-2)13-15-22;/h16H,4-15H2,1-3H3;1H |
| InChIKey | DLCPMBBDKFWYLO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|