About (E)-1,7-diphenylhept-6-en-3-one
(E)-1,7-diphenylhept-6-en-3-one (PubChem CID 44593373) has the molecular formula C19H20O
and a molecular weight of 264.37 g/mol. Its IUPAC name is (E)-1,7-diphenylhept-6-en-3-one.
Molecular Properties
| Compound Name | (E)-1,7-diphenylhept-6-en-3-one |
| PubChem CID | 44593373 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (E)-1,7-diphenylhept-6-en-3-one |
| SMILES | O=C(CC/C=C/c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H20O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-7,9-13H,8,14-16H2/b13-7+ |
| InChIKey | VNFWNGSEJXPCSW-NTUHNPAUSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-1,7-diphenylhept-6-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,7-diphenylhept-6-en-3-one?
The IUPAC name of (E)-1,7-diphenylhept-6-en-3-one (CID 44593373) is (E)-1,7-diphenylhept-6-en-3-one.
What is the SMILES notation for (E)-1,7-diphenylhept-6-en-3-one?
The canonical SMILES for (E)-1,7-diphenylhept-6-en-3-one is O=C(CC/C=C/c1ccccc1)CCc1ccccc1.
What is the InChIKey of (E)-1,7-diphenylhept-6-en-3-one?
The InChIKey is VNFWNGSEJXPCSW-NTUHNPAUSA-N. The full InChI is InChI=1S/C19H20O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-7,9-13H,8,14-16H2/b13-7+.
What are the key properties of (E)-1,7-diphenylhept-6-en-3-one?
(E)-1,7-diphenylhept-6-en-3-one has a molecular weight of 264.37 g/mol, XLogP of 4.68, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,7-diphenylhept-6-en-3-one is sourced from PubChem (CID 44593373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).