C13H14O5 — CID 44593375
(1R,4R,6R,8R,10R,11E,14R)-11-ethylidene-6-hydroxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one (PubChem CID 44593375) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (1R,4R,6R,8R,10R,11E,14R)-11-ethylidene-6-hydroxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one.
| Compound Name | (1R,4R,6R,8R,10R,11E,14R)-11-ethylidene-6-hydroxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one |
|---|---|
| PubChem CID | 44593375 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (1R,4R,6R,8R,10R,11E,14R)-11-ethylidene-6-hydroxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one |
| SMILES | C/C=C1/C(=O)O[C@@]23C=C[C@H]4C[C@H](O)O[C@@H](O[C@H]12)[C@H]43 |
| InChI | InChI=1S/C13H14O5/c1-2-7-10-13(18-11(7)15)4-3-6-5-8(14)16-12(17-10)9(6)13/h2-4,6,8-10,12,14H,5H2,1H3/b7-2+/t6-,8+,9-,10+,12-,13+/m0/s1 |
| InChIKey | DWWKELQVGKIHDR-MXXFXNOVSA-N |
| XLogP | 0.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|