About [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate
[4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate (PubChem CID 44593393) has the molecular formula C28H30N2O2
and a molecular weight of 426.56 g/mol. Its IUPAC name is [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate |
| PubChem CID | 44593393 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate |
| SMILES | CN(C)C12CC(OC(=O)c3cccnc3)C(C(c3ccccc3)C1)C(c1ccccc1)C2 |
| InChI | InChI=1S/C28H30N2O2/c1-30(2)28-16-23(20-10-5-3-6-11-20)26(24(17-28)21-12-7-4-8-13-21)25(18-28)32-27(31)22-14-9-15-29-19-22/h3-15,19,23-26H,16-18H2,1-2H3 |
| InChIKey | JYJAOXOVCMOQIU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate?
The IUPAC name of [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate (CID 44593393) is [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate.
What is the SMILES notation for [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate?
The canonical SMILES for [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate is CN(C)C12CC(OC(=O)c3cccnc3)C(C(c3ccccc3)C1)C(c1ccccc1)C2.
What is the InChIKey of [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate?
The InChIKey is JYJAOXOVCMOQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O2/c1-30(2)28-16-23(20-10-5-3-6-11-20)26(24(17-28)21-12-7-4-8-13-21)25(18-28)32-27(31)22-14-9-15-29-19-22/h3-15,19,23-26H,16-18H2,1-2H3.
What are the key properties of [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate?
[4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate has a molecular weight of 426.56 g/mol, XLogP of 5.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethylamino)-6,7-diphenyl-2-bicyclo[2.2.2]octanyl] pyridine-3-carboxylate is sourced from PubChem (CID 44593393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).