About 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide
4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 44593407) has the molecular formula C21H16F3N3O2
and a molecular weight of 399.37 g/mol. Its IUPAC name is 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| PubChem CID | 44593407 |
| Molecular Formula | C21H16F3N3O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C21H16F3N3O2/c1-13-7-8-14(10-18(13)20(29)27-17-6-3-9-25-12-17)19(28)26-16-5-2-4-15(11-16)21(22,23)24/h2-12H,1H3,(H,26,28)(H,27,29) |
| InChIKey | RAKQGQRMHIXLRO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide?
The IUPAC name of 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (CID 44593407) is 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
What is the SMILES notation for 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide?
The canonical SMILES for 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide is Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1C(=O)Nc1cccnc1.
What is the InChIKey of 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide?
The InChIKey is RAKQGQRMHIXLRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3O2/c1-13-7-8-14(10-18(13)20(29)27-17-6-3-9-25-12-17)19(28)26-16-5-2-4-15(11-16)21(22,23)24/h2-12H,1H3,(H,26,28)(H,27,29).
What are the key properties of 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide?
4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide has a molecular weight of 399.37 g/mol, XLogP of 4.91, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-N-pyridin-3-yl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide is sourced from PubChem (CID 44593407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).