C20H21FN4OS — CID 44593521
4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(oxan-4-yl)pyridin-2-amine (PubChem CID 44593521) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(oxan-4-yl)pyridin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(oxan-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 44593521 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(oxan-4-yl)pyridin-2-amine |
| SMILES | CSc1nc(-c2ccnc(NC3CCOCC3)c2)c(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C20H21FN4OS/c1-27-20-24-18(13-2-4-15(21)5-3-13)19(25-20)14-6-9-22-17(12-14)23-16-7-10-26-11-8-16/h2-6,9,12,16H,7-8,10-11H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | PPSHLZKKNUFIFL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |