C17H18FN3 — CID 44593642
(1R,2R,4R)-2-[5-(2-fluoro-4-pyridinyl)-3-pyridinyl]-7-methyl-7-azabicyclo[2.2.1]heptane (PubChem CID 44593642) has the molecular formula C17H18FN3 and a molecular weight of 283.35 g/mol. Its IUPAC name is (1R,2R,4R)-2-[5-(2-fluoro-4-pyridinyl)-3-pyridinyl]-7-methyl-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4R)-2-[5-(2-fluoro-4-pyridinyl)-3-pyridinyl]-7-methyl-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 44593642 |
| Molecular Formula | C17H18FN3 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (1R,2R,4R)-2-[5-(2-fluoro-4-pyridinyl)-3-pyridinyl]-7-methyl-7-azabicyclo[2.2.1]heptane |
| SMILES | CN1[C@@H]2CC[C@@H]1[C@@H](c1cncc(-c3ccnc(F)c3)c1)C2 |
| InChI | InChI=1S/C17H18FN3/c1-21-14-2-3-16(21)15(8-14)13-6-12(9-19-10-13)11-4-5-20-17(18)7-11/h4-7,9-10,14-16H,2-3,8H2,1H3/t14-,15-,16-/m1/s1 |
| InChIKey | QPAMZHIOZFVTFI-BZUAXINKSA-N |
| XLogP | 3.23 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|