About disodium;dioxido-oxo-phenyl-λ5-arsane
disodium;dioxido-oxo-phenyl-λ5-arsane (PubChem CID 44593649) has the molecular formula C6H5AsNa2O3
and a molecular weight of 246.00 g/mol. Its IUPAC name is disodium;dioxido-oxo-phenyl-λ5-arsane.
Molecular Properties
| Compound Name | disodium;dioxido-oxo-phenyl-λ5-arsane |
| PubChem CID | 44593649 |
| Molecular Formula | C6H5AsNa2O3 |
| Molecular Weight | 246.00 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | disodium;dioxido-oxo-phenyl-λ5-arsane |
| SMILES | O=[As]([O-])([O-])c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C6H7AsO3.2Na/c8-7(9,10)6-4-2-1-3-5-6;;/h1-5H,(H2,8,9,10);;/q;2*+1/p-2 |
| InChIKey | IDQWLYXYOJVSLB-UHFFFAOYSA-L |
| XLogP | -8.01 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.00 |
| LogP ≤ 5 | -8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze disodium;dioxido-oxo-phenyl-λ5-arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;dioxido-oxo-phenyl-λ5-arsane?
The IUPAC name of disodium;dioxido-oxo-phenyl-λ5-arsane (CID 44593649) is disodium;dioxido-oxo-phenyl-λ5-arsane.
What is the SMILES notation for disodium;dioxido-oxo-phenyl-λ5-arsane?
The canonical SMILES for disodium;dioxido-oxo-phenyl-λ5-arsane is O=[As]([O-])([O-])c1ccccc1.[Na+].[Na+].
What is the InChIKey of disodium;dioxido-oxo-phenyl-λ5-arsane?
The InChIKey is IDQWLYXYOJVSLB-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H7AsO3.2Na/c8-7(9,10)6-4-2-1-3-5-6;;/h1-5H,(H2,8,9,10);;/q;2*+1/p-2.
What are the key properties of disodium;dioxido-oxo-phenyl-λ5-arsane?
disodium;dioxido-oxo-phenyl-λ5-arsane has a molecular weight of 246.00 g/mol, XLogP of -8.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;dioxido-oxo-phenyl-λ5-arsane is sourced from PubChem (CID 44593649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).