C23H23F2N3O2 — CID 44593715
(3R)-8-fluoro-3-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 44593715) has the molecular formula C23H23F2N3O2 and a molecular weight of 411.45 g/mol. Its IUPAC name is (3R)-8-fluoro-3-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | (3R)-8-fluoro-3-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 44593715 |
| Molecular Formula | C23H23F2N3O2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (3R)-8-fluoro-3-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | NC(=O)c1ccc(F)c2c1C[C@@H](NCC1CCc3[nH]c4ccc(F)cc4c3C1)CO2 |
| InChI | InChI=1S/C23H23F2N3O2/c24-13-2-6-21-17(8-13)16-7-12(1-5-20(16)28-21)10-27-14-9-18-15(23(26)29)3-4-19(25)22(18)30-11-14/h2-4,6,8,12,14,27-28H,1,5,7,9-11H2,(H2,26,29)/t12?,14-/m1/s1 |
| InChIKey | HRBJVYYIBYQKRV-TYZXPVIJSA-N |
| XLogP | 3.24 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|