C18H26N2O — CID 44593719
(1R,5R)-6-[(4-methoxyphenyl)methyl]-8-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane (PubChem CID 44593719) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (1R,5R)-6-[(4-methoxyphenyl)methyl]-8-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane.
| Compound Name | (1R,5R)-6-[(4-methoxyphenyl)methyl]-8-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 44593719 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (1R,5R)-6-[(4-methoxyphenyl)methyl]-8-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonane |
| SMILES | C=CCN1C[C@H]2CCC[C@@H]1CN2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-3-11-19-13-17-6-4-5-16(19)14-20(17)12-15-7-9-18(21-2)10-8-15/h3,7-10,16-17H,1,4-6,11-14H2,2H3/t16-,17-/m1/s1 |
| InChIKey | QGVOZEZDHDGVCY-IAGOWNOFSA-N |
| XLogP | 2.92 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|