About 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide
3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide (PubChem CID 44593841) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide.
Molecular Properties
| Compound Name | 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide |
| PubChem CID | 44593841 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide |
| SMILES | NC(=O)CC[C@@H]1NC(=O)OC1=O |
| InChI | InChI=1S/C6H8N2O4/c7-4(9)2-1-3-5(10)12-6(11)8-3/h3H,1-2H2,(H2,7,9)(H,8,11)/t3-/m0/s1 |
| InChIKey | UBAGQWVWTSZVDI-VKHMYHEASA-N |
| XLogP | -1.11 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide?
The IUPAC name of 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide (CID 44593841) is 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide.
What is the SMILES notation for 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide?
The canonical SMILES for 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide is NC(=O)CC[C@@H]1NC(=O)OC1=O.
What is the InChIKey of 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide?
The InChIKey is UBAGQWVWTSZVDI-VKHMYHEASA-N. The full InChI is InChI=1S/C6H8N2O4/c7-4(9)2-1-3-5(10)12-6(11)8-3/h3H,1-2H2,(H2,7,9)(H,8,11)/t3-/m0/s1.
What are the key properties of 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide?
3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide has a molecular weight of 172.14 g/mol, XLogP of -1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanamide is sourced from PubChem (CID 44593841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).