C22H23ClN4O7 — CID 44594028
(3S)-3-(9-azido-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one;hydrochloride (PubChem CID 44594028) has the molecular formula C22H23ClN4O7 and a molecular weight of 490.90 g/mol. Its IUPAC name is (3S)-3-(9-azido-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one;hydrochloride.
| Compound Name | (3S)-3-(9-azido-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one;hydrochloride |
|---|---|
| PubChem CID | 44594028 |
| Molecular Formula | C22H23ClN4O7 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (3S)-3-(9-azido-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one;hydrochloride |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2C1c2c(c(N=[N+]=[N-])c3c(c2OC)OCO3)CCN1C.Cl |
| InChI | InChI=1S/C22H22N4O7.ClH/c1-26-8-7-10-13(19(30-4)21-20(31-9-32-21)15(10)24-25-23)16(26)17-11-5-6-12(28-2)18(29-3)14(11)22(27)33-17;/h5-6,16-17H,7-9H2,1-4H3;1H/t16?,17-;/m0./s1 |
| InChIKey | LDNXSNBKLMVFNP-KRNWZFANSA-N |
| XLogP | 4.25 |
| TPSA | 124.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|