C22H20N6 — CID 44594105
12-[4-(4-methylpiperazin-1-yl)phenyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 44594105) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is 12-[4-(4-methylpiperazin-1-yl)phenyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[4-(4-methylpiperazin-1-yl)phenyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 44594105 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 12-[4-(4-methylpiperazin-1-yl)phenyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | CN1CCN(c2ccc(-c3cnc4[nH]c5ccc(C#N)nc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C22H20N6/c1-27-8-10-28(11-9-27)18-5-2-15(3-6-18)16-12-19-21-20(26-22(19)24-14-16)7-4-17(13-23)25-21/h2-7,12,14H,8-11H2,1H3,(H,24,26) |
| InChIKey | VRCZLPVQUNNREW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |