C23H18F4N4O4S — CID 44594423
2-(1,3-dimethyl-2,4-dioxoquinazolin-5-yl)-N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 44594423) has the molecular formula C23H18F4N4O4S and a molecular weight of 522.48 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,4-dioxoquinazolin-5-yl)-N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,4-dioxoquinazolin-5-yl)-N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 44594423 |
| Molecular Formula | C23H18F4N4O4S |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 2-(1,3-dimethyl-2,4-dioxoquinazolin-5-yl)-N-[4-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cn1c(=O)c2c(CC(=O)Nc3nc(-c4ccc(OCC(F)(F)F)c(F)c4)cs3)cccc2n(C)c1=O |
| InChI | InChI=1S/C23H18F4N4O4S/c1-30-16-5-3-4-13(19(16)20(33)31(2)22(30)34)9-18(32)29-21-28-15(10-36-21)12-6-7-17(14(24)8-12)35-11-23(25,26)27/h3-8,10H,9,11H2,1-2H3,(H,28,29,32) |
| InChIKey | XDOHXIILAXDOIX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |