C25H45NO8 — CID 44595196
(2S)-N-[(S)-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide (PubChem CID 44595196) has the molecular formula C25H45NO8 and a molecular weight of 487.63 g/mol. Its IUPAC name is (2S)-N-[(S)-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide.
| Compound Name | (2S)-N-[(S)-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 44595196 |
| Molecular Formula | C25H45NO8 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | (2S)-N-[(S)-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
| SMILES | C=C1C[C@](OC)([C@H](O)C(=O)N[C@@H](OC)[C@@H]2CCC(C)(C)[C@@H](C[C@@H](COC)OC)O2)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H45NO8/c1-15-13-25(32-9,34-17(3)16(15)2)21(27)22(28)26-23(31-8)19-10-11-24(4,5)20(33-19)12-18(30-7)14-29-6/h16-21,23,27H,1,10-14H2,2-9H3,(H,26,28)/t16-,17-,18+,19+,20-,21-,23+,25-/m1/s1 |
| InChIKey | WSTYCZLPQWYIIU-JTLAVPBISA-N |
| XLogP | 2.41 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|