C14H17N3O2 — CID 44595471
2-[2-(1H-imidazol-2-ylamino)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 44595471) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[2-(1H-imidazol-2-ylamino)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[2-(1H-imidazol-2-ylamino)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 44595471 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-[2-(1H-imidazol-2-ylamino)ethyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCNc2ncc[nH]2)=C(C)C1=O |
| InChI | InChI=1S/C14H17N3O2/c1-8-9(2)13(19)11(10(3)12(8)18)4-5-15-14-16-6-7-17-14/h6-7H,4-5H2,1-3H3,(H2,15,16,17) |
| InChIKey | DGSZGZGUCNKHQJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|