C8H19N — CID 44596
2-Hexylamine, N,5-dimethyl- (PubChem CID 44596) has the molecular formula C8H19N and a molecular weight of 129.24 g/mol. Its IUPAC name is N,5-dimethylhexan-2-amine.
| Compound Name | 2-Hexylamine, N,5-dimethyl- |
|---|---|
| PubChem CID | 44596 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.24 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | N,5-dimethylhexan-2-amine |
| SMILES | CC(C)CCC(C)NC |
| InChI | InChI=1S/C8H19N/c1-7(2)5-6-8(3)9-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | VFQPKDNSCZTUMI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | 59 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |