C21H38O10 — CID 44596240
[3-hexanoyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexanoate (PubChem CID 44596240) has the molecular formula C21H38O10 and a molecular weight of 450.53 g/mol. Its IUPAC name is [3-hexanoyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexanoate.
| Compound Name | [3-hexanoyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexanoate |
|---|---|
| PubChem CID | 44596240 |
| Molecular Formula | C21H38O10 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | [3-hexanoyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexanoate |
| SMILES | CCCCCC(=O)OCC(COC(=O)CCCCC)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H38O10/c1-3-5-7-9-16(23)28-12-14(13-29-17(24)10-8-6-4-2)30-21-20(27)19(26)18(25)15(11-22)31-21/h14-15,18-22,25-27H,3-13H2,1-2H3/t15-,18-,19+,20-,21-/m1/s1 |
| InChIKey | FFPCAZMUDTXKSB-CMWLGVBASA-N |
| XLogP | 0.42 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|