About N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine
N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine (PubChem CID 44596423) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine.
Molecular Properties
| Compound Name | N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine |
| PubChem CID | 44596423 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine |
| SMILES | CC1(C)OC1/C=N/c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-18(2)17(20-18)13-19-16-11-7-6-10-15(16)12-14-8-4-3-5-9-14/h3-11,13,17H,12H2,1-2H3/b19-13+ |
| InChIKey | XSAVWJLIJZQVBA-CPNJWEJPSA-N |
| XLogP | 4.16 |
| TPSA | 24.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine?
The IUPAC name of N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine (CID 44596423) is N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine.
What is the SMILES notation for N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine?
The canonical SMILES for N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine is CC1(C)OC1/C=N/c1ccccc1Cc1ccccc1.
What is the InChIKey of N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine?
The InChIKey is XSAVWJLIJZQVBA-CPNJWEJPSA-N. The full InChI is InChI=1S/C18H19NO/c1-18(2)17(20-18)13-19-16-11-7-6-10-15(16)12-14-8-4-3-5-9-14/h3-11,13,17H,12H2,1-2H3/b19-13+.
What are the key properties of N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine?
N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine has a molecular weight of 265.36 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-benzylphenyl)-1-(3,3-dimethyloxiran-2-yl)methanimine is sourced from PubChem (CID 44596423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).