About 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one
4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one (PubChem CID 44596563) has the molecular formula C22H20IN3O2
and a molecular weight of 485.33 g/mol. Its IUPAC name is 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one |
| PubChem CID | 44596563 |
| Molecular Formula | C22H20IN3O2 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C)cc(Oc2c(Cn3ncc4ccccc43)c(C)[nH]c(=O)c2I)c1 |
| InChI | InChI=1S/C22H20IN3O2/c1-13-8-14(2)10-17(9-13)28-21-18(15(3)25-22(27)20(21)23)12-26-19-7-5-4-6-16(19)11-24-26/h4-11H,12H2,1-3H3,(H,25,27) |
| InChIKey | OPRQNSFAIOZFII-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one?
The IUPAC name of 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one (CID 44596563) is 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one.
What is the SMILES notation for 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one?
The canonical SMILES for 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one is Cc1cc(C)cc(Oc2c(Cn3ncc4ccccc43)c(C)[nH]c(=O)c2I)c1.
What is the InChIKey of 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one?
The InChIKey is OPRQNSFAIOZFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20IN3O2/c1-13-8-14(2)10-17(9-13)28-21-18(15(3)25-22(27)20(21)23)12-26-19-7-5-4-6-16(19)11-24-26/h4-11H,12H2,1-3H3,(H,25,27).
What are the key properties of 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one?
4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one has a molecular weight of 485.33 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenoxy)-5-(indazol-1-ylmethyl)-3-iodo-6-methyl-1H-pyridin-2-one is sourced from PubChem (CID 44596563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).