C21H29N5O — CID 44596863
4-amino-5-ethenyl-6-methyl-2-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]pyridazin-3-one (PubChem CID 44596863) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-amino-5-ethenyl-6-methyl-2-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]pyridazin-3-one.
| Compound Name | 4-amino-5-ethenyl-6-methyl-2-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 44596863 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 4-amino-5-ethenyl-6-methyl-2-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]pyridazin-3-one |
| SMILES | C=Cc1c(C)nn(CCCN2CCN(c3ccc(C)cc3)CC2)c(=O)c1N |
| InChI | InChI=1S/C21H29N5O/c1-4-19-17(3)23-26(21(27)20(19)22)11-5-10-24-12-14-25(15-13-24)18-8-6-16(2)7-9-18/h4,6-9H,1,5,10-15,22H2,2-3H3 |
| InChIKey | SSHKNPUBWWFZGC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|