C35H38N4O6S2 — CID 44596867
N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]thiophene-2-sulfonamide (PubChem CID 44596867) has the molecular formula C35H38N4O6S2 and a molecular weight of 674.85 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 44596867 |
| Molecular Formula | C35H38N4O6S2 |
| Molecular Weight | 674.85 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(C(CCNS(=O)(=O)c2cccs2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C35H38N4O6S2/c1-24(25-9-5-4-6-10-25)37-18-20-38(21-19-37)29-12-7-11-27-33(29)35(41)39(34(27)40)28(26-14-15-30(44-2)31(23-26)45-3)16-17-36-47(42,43)32-13-8-22-46-32/h4-15,22-24,28,36H,16-21H2,1-3H3/t24-,28?/m1/s1 |
| InChIKey | XWEJKOCDJCMFCN-RIBGEGAISA-N |
| XLogP | 5.35 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|