C29H34N4O6S2 — CID 44596870
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide (PubChem CID 44596870) has the molecular formula C29H34N4O6S2 and a molecular weight of 598.75 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 44596870 |
| Molecular Formula | C29H34N4O6S2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2cccs2)N2C(=O)c3cccc(N4CCN(C)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C29H34N4O6S2/c1-31-14-16-32(17-15-31)23-8-4-7-21-27(23)29(35)33(28(21)34)22(20-11-12-24(38-2)25(19-20)39-3)9-5-13-30-41(36,37)26-10-6-18-40-26/h4,6-8,10-12,18-19,22,30H,5,9,13-17H2,1-3H3/t22-/m1/s1 |
| InChIKey | QVOADEILYCLCKY-JOCHJYFZSA-N |
| XLogP | 3.61 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|