C30H36N4O6S2 — CID 44596964
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide (PubChem CID 44596964) has the molecular formula C30H36N4O6S2 and a molecular weight of 612.77 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 44596964 |
| Molecular Formula | C30H36N4O6S2 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]butyl]thiophene-2-sulfonamide |
| SMILES | CCN1CCN(c2cccc3c2C(=O)N([C@H](CCCNS(=O)(=O)c2cccs2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C30H36N4O6S2/c1-4-32-15-17-33(18-16-32)24-9-5-8-22-28(24)30(36)34(29(22)35)23(21-12-13-25(39-2)26(20-21)40-3)10-6-14-31-42(37,38)27-11-7-19-41-27/h5,7-9,11-13,19-20,23,31H,4,6,10,14-18H2,1-3H3/t23-/m1/s1 |
| InChIKey | ZCTNRDFMOMOCAX-HSZRJFAPSA-N |
| XLogP | 4.00 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|