C29H41N3O3 — CID 44596973
(3R)-7-hydroxy-N-[(2S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 44596973) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is (3R)-7-hydroxy-N-[(2S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3R)-7-hydroxy-N-[(2S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 44596973 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | (3R)-7-hydroxy-N-[(2S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | COc1cccc([C@]2(C)CCN(C[C@@H](NC(=O)[C@H]3Cc4ccc(O)cc4CN3)C(C)C)C[C@@H]2C)c1 |
| InChI | InChI=1S/C29H41N3O3/c1-19(2)27(31-28(34)26-14-21-9-10-24(33)13-22(21)16-30-26)18-32-12-11-29(4,20(3)17-32)23-7-6-8-25(15-23)35-5/h6-10,13,15,19-20,26-27,30,33H,11-12,14,16-18H2,1-5H3,(H,31,34)/t20-,26+,27+,29+/m0/s1 |
| InChIKey | DXQSWBPXHPUDDS-XAOJMSMDSA-N |
| XLogP | 3.86 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |