C30H43N3O3 — CID 44596974
(3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 44596974) has the molecular formula C30H43N3O3 and a molecular weight of 493.69 g/mol. Its IUPAC name is (3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 44596974 |
| Molecular Formula | C30H43N3O3 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | (3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4R)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CC[C@H](C)[C@@H](CN1CC[C@@](C)(c2cccc(OC)c2)[C@@H](C)C1)NC(=O)[C@H]1Cc2ccc(O)cc2CN1 |
| InChI | InChI=1S/C30H43N3O3/c1-6-20(2)28(32-29(35)27-15-22-10-11-25(34)14-23(22)17-31-27)19-33-13-12-30(4,21(3)18-33)24-8-7-9-26(16-24)36-5/h7-11,14,16,20-21,27-28,31,34H,6,12-13,15,17-19H2,1-5H3,(H,32,35)/t20-,21-,27+,28+,30+/m0/s1 |
| InChIKey | APNWWOWCBHLGTF-GLSIXWEXSA-N |
| XLogP | 4.25 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |