C12H22Si — CID 44597123
1,1-dimethyl-3-(4-methylpent-3-enyl)-2,5-dihydrosilole (PubChem CID 44597123) has the molecular formula C12H22Si and a molecular weight of 194.39 g/mol. Its IUPAC name is 1,1-dimethyl-3-(4-methylpent-3-enyl)-2,5-dihydrosilole.
| Compound Name | 1,1-dimethyl-3-(4-methylpent-3-enyl)-2,5-dihydrosilole |
|---|---|
| PubChem CID | 44597123 |
| Molecular Formula | C12H22Si |
| Molecular Weight | 194.39 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1,1-dimethyl-3-(4-methylpent-3-enyl)-2,5-dihydrosilole |
| SMILES | CC(C)=CCCC1=CC[Si](C)(C)C1 |
| InChI | InChI=1S/C12H22Si/c1-11(2)6-5-7-12-8-9-13(3,4)10-12/h6,8H,5,7,9-10H2,1-4H3 |
| InChIKey | ALDJNZSOZWFHFF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|