C28H26FN3O4 — CID 44597225
(E)-3-(2,4-dimethoxyphenyl)-N-[4-[3-(4-fluorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]-2-pyridinyl]prop-2-enamide (PubChem CID 44597225) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-[4-[3-(4-fluorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]-2-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-[4-[3-(4-fluorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 44597225 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-[4-[3-(4-fluorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]-2-pyridinyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc(-c3c(-c4ccc(F)cc4)noc3C(C)C)ccn2)c(OC)c1 |
| InChI | InChI=1S/C28H26FN3O4/c1-17(2)28-26(27(32-36-28)19-5-9-21(29)10-6-19)20-13-14-30-24(15-20)31-25(33)12-8-18-7-11-22(34-3)16-23(18)35-4/h5-17H,1-4H3,(H,30,31,33)/b12-8+ |
| InChIKey | HSYSAQACEYOOEZ-XYOKQWHBSA-N |
| XLogP | 6.34 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|