C23H41NO2 — CID 44597381
1-[(4S)-4-methylpentadecyl]pyridin-1-ium acetate (PubChem CID 44597381) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is 1-[(4S)-4-methylpentadecyl]pyridin-1-ium acetate.
| Compound Name | 1-[(4S)-4-methylpentadecyl]pyridin-1-ium acetate |
|---|---|
| PubChem CID | 44597381 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | 1-[(4S)-4-methylpentadecyl]pyridin-1-ium acetate |
| SMILES | CC(=O)[O-].CCCCCCCCCCC[C@H](C)CCC[n+]1ccccc1 |
| InChI | InChI=1S/C21H38N.C2H4O2/c1-3-4-5-6-7-8-9-10-12-16-21(2)17-15-20-22-18-13-11-14-19-22;1-2(3)4/h11,13-14,18-19,21H,3-10,12,15-17,20H2,1-2H3;1H3,(H,3,4)/q+1;/p-1/t21-;/m0./s1 |
| InChIKey | YQDWEXBRHLQEAW-BOXHHOBZSA-M |
| XLogP | 5.07 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|