C24H32Br4N6 — CID 44597477
1,7-bis[[6-(bromomethyl)-2-pyridinyl]methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane dibromide (PubChem CID 44597477) has the molecular formula C24H32Br4N6 and a molecular weight of 724.18 g/mol. Its IUPAC name is 1,7-bis[[6-(bromomethyl)-2-pyridinyl]methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane dibromide.
| Compound Name | 1,7-bis[[6-(bromomethyl)-2-pyridinyl]methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane dibromide |
|---|---|
| PubChem CID | 44597477 |
| Molecular Formula | C24H32Br4N6 |
| Molecular Weight | 724.18 g/mol |
| Exact Mass | 719.94 |
| IUPAC Name | 1,7-bis[[6-(bromomethyl)-2-pyridinyl]methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane dibromide |
| SMILES | BrCc1cccc(C[N+]23CCN4CC[N+]5(Cc6cccc(CBr)n6)CCN(CC2)C5C43)n1.[Br-].[Br-] |
| InChI | InChI=1S/C24H32Br2N6.2BrH/c25-15-19-3-1-5-21(27-19)17-31-11-7-29-10-14-32(18-22-6-2-4-20(16-26)28-22)12-8-30(9-13-31)24(32)23(29)31;;/h1-6,23-24H,7-18H2;2*1H/q+2;;/p-2 |
| InChIKey | ATFWVESTRPAEDR-UHFFFAOYSA-L |
| XLogP | -3.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.18 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|