C35H53NO4 — CID 44597940
10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,2,9,9-tetramethyl-10-oxodecanoic acid (PubChem CID 44597940) has the molecular formula C35H53NO4 and a molecular weight of 551.81 g/mol. Its IUPAC name is 10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,2,9,9-tetramethyl-10-oxodecanoic acid.
| Compound Name | 10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,2,9,9-tetramethyl-10-oxodecanoic acid |
|---|---|
| PubChem CID | 44597940 |
| Molecular Formula | C35H53NO4 |
| Molecular Weight | 551.81 g/mol |
| Exact Mass | 551.40 |
| IUPAC Name | 10-[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2,2,9,9-tetramethyl-10-oxodecanoic acid |
| SMILES | CC(C)(CCCCCCC(C)(C)C(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3)C(=O)O |
| InChI | InChI=1S/C35H53NO4/c1-33(2,31(37)38)17-8-5-6-9-18-34(3,4)32(39)40-27-16-15-26-22-30-28-14-7-10-19-35(28,29(26)23-27)20-21-36(30)24-25-12-11-13-25/h15-16,23,25,28,30H,5-14,17-22,24H2,1-4H3,(H,37,38)/t28-,30+,35+/m0/s1 |
| InChIKey | YRNGHDGAXGHHKC-UNPBUSPFSA-N |
| XLogP | 7.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.81 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|