C10H15NO — CID 44598023
(9Z,10aR)-2,5,6,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-3-one (PubChem CID 44598023) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (9Z,10aR)-2,5,6,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-3-one.
| Compound Name | (9Z,10aR)-2,5,6,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-3-one |
|---|---|
| PubChem CID | 44598023 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (9Z,10aR)-2,5,6,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-3-one |
| SMILES | O=C1CC[C@@H]2/C=C\CCCCN12 |
| InChI | InChI=1S/C10H15NO/c12-10-7-6-9-5-3-1-2-4-8-11(9)10/h3,5,9H,1-2,4,6-8H2/b5-3-/t9-/m0/s1 |
| InChIKey | KQGOCYVQEPPVDF-LVCFMKKZSA-N |
| XLogP | 1.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|