About (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine
(2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine (PubChem CID 44598246) has the molecular formula C21H27N
and a molecular weight of 293.45 g/mol. Its IUPAC name is (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine.
Molecular Properties
| Compound Name | (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine |
| PubChem CID | 44598246 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine |
| SMILES | CN1[C@@H](CCc2ccccc2)CC[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C21H27N/c1-22-20(14-12-18-8-4-2-5-9-18)16-17-21(22)15-13-19-10-6-3-7-11-19/h2-11,20-21H,12-17H2,1H3/t20-,21-/m0/s1 |
| InChIKey | KTRZGLCVCAVBHT-SFTDATJTSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine?
The IUPAC name of (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine (CID 44598246) is (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine.
What is the SMILES notation for (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine?
The canonical SMILES for (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine is CN1[C@@H](CCc2ccccc2)CC[C@@H]1CCc1ccccc1.
What is the InChIKey of (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine?
The InChIKey is KTRZGLCVCAVBHT-SFTDATJTSA-N. The full InChI is InChI=1S/C21H27N/c1-22-20(14-12-18-8-4-2-5-9-18)16-17-21(22)15-13-19-10-6-3-7-11-19/h2-11,20-21H,12-17H2,1H3/t20-,21-/m0/s1.
What are the key properties of (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine?
(2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine has a molecular weight of 293.45 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1-methyl-2,5-bis(2-phenylethyl)pyrrolidine is sourced from PubChem (CID 44598246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).