About (2S,5R)-2,5-dibenzylpyrrolidine
(2S,5R)-2,5-dibenzylpyrrolidine (PubChem CID 44598295) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is (2S,5R)-2,5-dibenzylpyrrolidine.
Molecular Properties
| Compound Name | (2S,5R)-2,5-dibenzylpyrrolidine |
| PubChem CID | 44598295 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (2S,5R)-2,5-dibenzylpyrrolidine |
| SMILES | c1ccc(C[C@H]2CC[C@@H](Cc3ccccc3)N2)cc1 |
| InChI | InChI=1S/C18H21N/c1-3-7-15(8-4-1)13-17-11-12-18(19-17)14-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18+ |
| InChIKey | JWFLOEKZECISRU-HDICACEKSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,5R)-2,5-dibenzylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2,5-dibenzylpyrrolidine?
The IUPAC name of (2S,5R)-2,5-dibenzylpyrrolidine (CID 44598295) is (2S,5R)-2,5-dibenzylpyrrolidine.
What is the SMILES notation for (2S,5R)-2,5-dibenzylpyrrolidine?
The canonical SMILES for (2S,5R)-2,5-dibenzylpyrrolidine is c1ccc(C[C@H]2CC[C@@H](Cc3ccccc3)N2)cc1.
What is the InChIKey of (2S,5R)-2,5-dibenzylpyrrolidine?
The InChIKey is JWFLOEKZECISRU-HDICACEKSA-N. The full InChI is InChI=1S/C18H21N/c1-3-7-15(8-4-1)13-17-11-12-18(19-17)14-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18+.
What are the key properties of (2S,5R)-2,5-dibenzylpyrrolidine?
(2S,5R)-2,5-dibenzylpyrrolidine has a molecular weight of 251.37 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2,5-dibenzylpyrrolidine is sourced from PubChem (CID 44598295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).