C23H32N2O4 — CID 44598348
2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-5-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 44598348) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-5-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-5-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 44598348 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-5-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCCCCNC1=CC(=O)C(OC)=CC1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C23H32N2O4/c1-4-25(17-18-11-7-8-12-22(18)28-2)14-10-6-5-9-13-24-19-15-21(27)23(29-3)16-20(19)26/h7-8,11-12,15-16,24H,4-6,9-10,13-14,17H2,1-3H3 |
| InChIKey | CJKYCZXICOUJLW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|