C20H39N — CID 445984
3,7-Dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nonan-1-amine (PubChem CID 445984) has the molecular formula C20H39N and a molecular weight of 293.50 g/mol. Its IUPAC name is 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nonan-1-amine.
| Compound Name | 3,7-Dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nonan-1-amine |
|---|---|
| PubChem CID | 445984 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nonan-1-amine |
| SMILES | CC1=C(C(CCC1)(C)C)CCC(C)CCCC(C)CCN |
| InChI | InChI=1S/C20H39N/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h16-17H,6-15,21H2,1-5H3 |
| InChIKey | KTXJILOXJQRPSL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | 327 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|