C24H27F4N3O2 — CID 44598820
pyridin-4-yl-[9-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone (PubChem CID 44598820) has the molecular formula C24H27F4N3O2 and a molecular weight of 465.49 g/mol. Its IUPAC name is pyridin-4-yl-[9-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone.
| Compound Name | pyridin-4-yl-[9-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone |
|---|---|
| PubChem CID | 44598820 |
| Molecular Formula | C24H27F4N3O2 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | pyridin-4-yl-[9-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone |
| SMILES | O=C(c1ccncc1)N1CCC2(CCN(Cc3ccccc3OC(F)(F)C(F)F)CC2)CC1 |
| InChI | InChI=1S/C24H27F4N3O2/c25-22(26)24(27,28)33-20-4-2-1-3-19(20)17-30-13-7-23(8-14-30)9-15-31(16-10-23)21(32)18-5-11-29-12-6-18/h1-6,11-12,22H,7-10,13-17H2 |
| InChIKey | ZQYTURKIACTXPU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|