About 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one
8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one (PubChem CID 44599243) has the molecular formula C25H15FO4
and a molecular weight of 398.39 g/mol. Its IUPAC name is 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one.
Molecular Properties
| Compound Name | 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one |
| PubChem CID | 44599243 |
| Molecular Formula | C25H15FO4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3ccccc3)c(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C25H15FO4/c1-14-13-20(27)30-24-18(14)11-12-19-22(24)21(15-7-9-17(26)10-8-15)25(29-19)23(28)16-5-3-2-4-6-16/h2-13H,1H3 |
| InChIKey | FAKJSGKIEMJNBL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one?
The IUPAC name of 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one (CID 44599243) is 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one.
What is the SMILES notation for 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one?
The canonical SMILES for 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one is Cc1cc(=O)oc2c1ccc1oc(C(=O)c3ccccc3)c(-c3ccc(F)cc3)c12.
What is the InChIKey of 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one?
The InChIKey is FAKJSGKIEMJNBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H15FO4/c1-14-13-20(27)30-24-18(14)11-12-19-22(24)21(15-7-9-17(26)10-8-15)25(29-19)23(28)16-5-3-2-4-6-16/h2-13H,1H3.
What are the key properties of 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one?
8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one has a molecular weight of 398.39 g/mol, XLogP of 5.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzoyl-9-(4-fluorophenyl)-4-methylfuro[2,3-h]chromen-2-one is sourced from PubChem (CID 44599243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).