C7H4F12O2 — CID 44599462
1,1,1,2,3,3-hexafluoro-3-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethoxy]propane (PubChem CID 44599462) has the molecular formula C7H4F12O2 and a molecular weight of 348.08 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethoxy]propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethoxy]propane |
|---|---|
| PubChem CID | 44599462 |
| Molecular Formula | C7H4F12O2 |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethoxy]propane |
| SMILES | FC(C(F)(F)F)C(F)(F)OC(OCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H4F12O2/c8-2(5(12,13)14)7(18,19)21-3(6(15,16)17)20-1-4(9,10)11/h2-3H,1H2 |
| InChIKey | SVOWYNZTWGLWOZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|