About N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide
N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide (PubChem CID 44599936) has the molecular formula C17H22N4OS
and a molecular weight of 330.46 g/mol. Its IUPAC name is N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide.
Molecular Properties
| Compound Name | N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide |
| PubChem CID | 44599936 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide |
| SMILES | CN(C)CCN1CCOc2cc(/N=C(\N)c3cccs3)ccc21 |
| InChI | InChI=1S/C17H22N4OS/c1-20(2)7-8-21-9-10-22-15-12-13(5-6-14(15)21)19-17(18)16-4-3-11-23-16/h3-6,11-12H,7-10H2,1-2H3,(H2,18,19) |
| InChIKey | LVLXDRARRDWIKO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide?
The IUPAC name of N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide (CID 44599936) is N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide.
What is the SMILES notation for N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide?
The canonical SMILES for N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide is CN(C)CCN1CCOc2cc(/N=C(\N)c3cccs3)ccc21.
What is the InChIKey of N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide?
The InChIKey is LVLXDRARRDWIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4OS/c1-20(2)7-8-21-9-10-22-15-12-13(5-6-14(15)21)19-17(18)16-4-3-11-23-16/h3-6,11-12H,7-10H2,1-2H3,(H2,18,19).
What are the key properties of N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide?
N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide has a molecular weight of 330.46 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-[2-(dimethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide is sourced from PubChem (CID 44599936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).