C17H22N4OS — CID 44599937
N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide (PubChem CID 44599937) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 44599937 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]thiophene-2-carboximidamide |
| SMILES | CCNCCN1CCOc2cc(/N=C(\N)c3cccs3)ccc21 |
| InChI | InChI=1S/C17H22N4OS/c1-2-19-7-8-21-9-10-22-15-12-13(5-6-14(15)21)20-17(18)16-4-3-11-23-16/h3-6,11-12,19H,2,7-10H2,1H3,(H2,18,20) |
| InChIKey | SVSDOBDCHUJTMR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|