C17H18N4O2 — CID 44600650
[3-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)phenyl]methanol (PubChem CID 44600650) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is [3-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)phenyl]methanol.
| Compound Name | [3-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 44600650 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [3-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)phenyl]methanol |
| SMILES | OCc1cccc(-c2nc(N3CCOCC3)c3cc[nH]c3n2)c1 |
| InChI | InChI=1S/C17H18N4O2/c22-11-12-2-1-3-13(10-12)15-19-16-14(4-5-18-16)17(20-15)21-6-8-23-9-7-21/h1-5,10,22H,6-9,11H2,(H,18,19,20) |
| InChIKey | XVXQABBPJCCJQM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |