C20H20N6O3S — CID 44601518
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone (PubChem CID 44601518) has the molecular formula C20H20N6O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone |
|---|---|
| PubChem CID | 44601518 |
| Molecular Formula | C20H20N6O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone |
| SMILES | Nc1nc(SCC(=O)N2N=C3/C(=C\c4ccco4)CCCC3C2c2ccco2)n[nH]1 |
| InChI | InChI=1S/C20H20N6O3S/c21-19-22-20(24-23-19)30-11-16(27)26-18(15-7-3-9-29-15)14-6-1-4-12(17(14)25-26)10-13-5-2-8-28-13/h2-3,5,7-10,14,18H,1,4,6,11H2,(H3,21,22,23,24)/b12-10- |
| InChIKey | MVXYVZRYAOLSFW-BENRWUELSA-N |
| XLogP | 3.49 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |