C33H45ClN4O3 — CID 44601644
(1S,3R,12bS)-9-chloro-3-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-12b-methyl-4-oxo-N,N-di(propan-2-yl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide (PubChem CID 44601644) has the molecular formula C33H45ClN4O3 and a molecular weight of 581.20 g/mol. Its IUPAC name is (1S,3R,12bS)-9-chloro-3-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-12b-methyl-4-oxo-N,N-di(propan-2-yl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide.
| Compound Name | (1S,3R,12bS)-9-chloro-3-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-12b-methyl-4-oxo-N,N-di(propan-2-yl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide |
|---|---|
| PubChem CID | 44601644 |
| Molecular Formula | C33H45ClN4O3 |
| Molecular Weight | 581.20 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | (1S,3R,12bS)-9-chloro-3-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-12b-methyl-4-oxo-N,N-di(propan-2-yl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide |
| SMILES | CC(C)N(C(=O)[C@H]1C[C@H](CC(=O)NCCC2=CCCCC2)C(=O)N2CCc3c([nH]c4ccc(Cl)cc34)[C@]12C)C(C)C |
| InChI | InChI=1S/C33H45ClN4O3/c1-20(2)38(21(3)4)32(41)27-17-23(18-29(39)35-15-13-22-9-7-6-8-10-22)31(40)37-16-14-25-26-19-24(34)11-12-28(26)36-30(25)33(27,37)5/h9,11-12,19-21,23,27,36H,6-8,10,13-18H2,1-5H3,(H,35,39)/t23-,27-,33+/m1/s1 |
| InChIKey | SWSFLVWOKXHALU-OTEOEGHSSA-N |
| XLogP | 6.10 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.20 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|