C26H26N4OS — CID 44601717
2-[(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 44601717) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-[(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 44601717 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1sc(N2N=C3/C(=C\c4ccccc4)CCCC3C2c2ccccc2)nc1C |
| InChI | InChI=1S/C26H26N4OS/c1-17-24(25(31)27-2)32-26(28-17)30-23(19-12-7-4-8-13-19)21-15-9-14-20(22(21)29-30)16-18-10-5-3-6-11-18/h3-8,10-13,16,21,23H,9,14-15H2,1-2H3,(H,27,31)/b20-16- |
| InChIKey | FCHAMQYISDHWJM-SILNSSARSA-N |
| XLogP | 5.61 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |