C24H35NO8 — CID 44601725
[(S)-[(1S,5S,7R)-5-methyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]-phenylmethyl] N-[3-(3,5-dihydroxy-6-methyloxan-2-yl)oxypropyl]carbamate (PubChem CID 44601725) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is [(S)-[(1S,5S,7R)-5-methyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]-phenylmethyl] N-[3-(3,5-dihydroxy-6-methyloxan-2-yl)oxypropyl]carbamate.
| Compound Name | [(S)-[(1S,5S,7R)-5-methyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]-phenylmethyl] N-[3-(3,5-dihydroxy-6-methyloxan-2-yl)oxypropyl]carbamate |
|---|---|
| PubChem CID | 44601725 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | [(S)-[(1S,5S,7R)-5-methyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]-phenylmethyl] N-[3-(3,5-dihydroxy-6-methyloxan-2-yl)oxypropyl]carbamate |
| SMILES | CC1OC(OCCCNC(=O)O[C@@H](c2ccccc2)[C@@H]2O[C@@]3(C)CCC[C@@H]2O3)C(O)CC1O |
| InChI | InChI=1S/C24H35NO8/c1-15-17(26)14-18(27)22(30-15)29-13-7-12-25-23(28)31-20(16-8-4-3-5-9-16)21-19-10-6-11-24(2,32-19)33-21/h3-5,8-9,15,17-22,26-27H,6-7,10-14H2,1-2H3,(H,25,28)/t15?,17?,18?,19-,20-,21+,22?,24-/m0/s1 |
| InChIKey | WJZOXYPIQKDZDV-FCFKUJLMSA-N |
| XLogP | 2.40 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|