C37H47N5O5 — CID 44601800
2-[(1S,12bS)-12b-(2-cyclopentylethyl)-9-methoxy-1-(morpholine-4-carbonyl)-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-3-yl]-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 44601800) has the molecular formula C37H47N5O5 and a molecular weight of 641.81 g/mol. Its IUPAC name is 2-[(1S,12bS)-12b-(2-cyclopentylethyl)-9-methoxy-1-(morpholine-4-carbonyl)-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-3-yl]-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-[(1S,12bS)-12b-(2-cyclopentylethyl)-9-methoxy-1-(morpholine-4-carbonyl)-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-3-yl]-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 44601800 |
| Molecular Formula | C37H47N5O5 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.36 |
| IUPAC Name | 2-[(1S,12bS)-12b-(2-cyclopentylethyl)-9-methoxy-1-(morpholine-4-carbonyl)-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-3-yl]-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)C(CC(=O)NCCc2ccccn2)C[C@H](C(=O)N2CCOCC2)[C@@]31CCC1CCCC1 |
| InChI | InChI=1S/C37H47N5O5/c1-46-28-9-10-32-30(24-28)29-13-17-42-35(44)26(23-33(43)39-16-12-27-8-4-5-15-38-27)22-31(36(45)41-18-20-47-21-19-41)37(42,34(29)40-32)14-11-25-6-2-3-7-25/h4-5,8-10,15,24-26,31,40H,2-3,6-7,11-14,16-23H2,1H3,(H,39,43)/t26?,31-,37+/m1/s1 |
| InChIKey | YEDLKHTVQSDDAJ-QZXNFUCGSA-N |
| XLogP | 4.37 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |